Parent API
| Product Code | Ax-IMP738 |
| CAS Number | 945668-94-0 |
| Molecular Formula | C30H24N4S2 |
| Molecular Weight | 504.67 |
| Synonyms | 1,4-bis(dibenzo[b,f][1,4]thiazepin-11-yl)piperazine |
| Purity | 96.00% |
| MDL No. | NA |
| Smile Code | N1(C2=NC3=CC=CC=C3SC4=CC=CC=C24)CCN(C5=NC6=CC=CC=C6SC7=CC=CC=C57)CC1 |
| Melting Point | >274°C |
| Boiling Point | NA |
| Production Scale | NULL |
| Production Cycle | NULL |