Parent API
| Product Code | Ax-IMP739 |
| CAS Number | 111974-72-2 |
| Molecular Formula | C21H25N3O2S·1/2C4H4O4 |
| Molecular Weight | 441.55 |
| Synonyms | 2-[2-(4-dibenzo[b,f][1,4]thiazepin-11-yl-1-piperazinyl)ethoxy]ethanol hemifumarate |
| Purity | 94.00% |
| MDL No. | MFCD03423782 |
| Smile Code | OCCOCCN1CCN(C2=NC3=CC=CC=C3SC4=CC=CC=C24)CC1.O=C(O)/C=C/C(O)=O |
| Melting Point | 172 - 176°C |
| Boiling Point | NA |
| Production Scale | NULL |
| Production Cycle | NULL |