Parent API
| Product Code | Ax-IMP1076 |
| CAS Number | 1011758-03-4 |
| Molecular Formula | C19H23Cl2N3S |
| Molecular Weight | 396.37 |
| Synonyms | 11-(4-ethylpiperazin-1-yl)dibenzo[b,f][1,4]thiazepine dihydrochloride |
| Purity | 96.00% |
| MDL No. | NA |
| Smile Code | CCN1CCN(C2=NC3=CC=CC=C3SC4=CC=CC=C24)CC1.[H]Cl.[H]Cl |
| Melting Point | NA |
| Boiling Point | NA |
| Production Scale | NULL |
| Production Cycle | NULL |