Parent API
| Product Code | Ax-IMP548 |
| CAS Number | 1076199-40-0 |
| Molecular Formula | C21H25N3O3S |
| Molecular Weight | 399.51 |
| Synonyms | 4-(dibenzo[b,f][1,4]thiazepin-11-yl)-1-(2-(2-hydroxyethoxy)ethyl)piperazine 1-oxide |
| Purity | 96.00% |
| MDL No. | NA |
| Smile Code | OCCOCC[N+]1([O-])CCN(C2=NC3=CC=CC=C3SC4=CC=CC=C24)CC1 |
| Melting Point | >96°C |
| Boiling Point | NA |
| Production Scale | NULL |
| Production Cycle | NULL |