Parent API
| Product Code | Ax-IMP910 |
| CAS Number | 168167-49-5 |
| Molecular Formula | C7H8N2O3 |
| Molecular Weight | 168.15 |
| Synonyms | (3-methyl-4-nitropyridin-2-yl)methanol |
| Purity | 96.00% |
| MDL No. | MFCD06658172 |
| Smile Code | OCC1=NC=CC([N+]([O-])=O)=C1C |
| Melting Point | NA |
| Boiling Point | NA |
| Production Scale | NULL |
| Production Cycle | NULL |