Parent API
| Product Code | Ax-IMP1763 |
| CAS Number | NA |
| Molecular Formula | C23H28F2N6O4S |
| Molecular Weight | 522.57 |
| Synonyms | (1S,2S,3R,5S)-3-(7-(((1R,2R)-2-(3,4-difluorophenyl)cyclopropyl)amino)-5-(propylthio)-3H-[1,2,3]triazolo[4,5-d]pyrimidin-3-yl)-5-(2-hydroxyethoxy)cyclopentane-1,2-diol |
| Purity | 92.00% |
| MDL No. | NA |
| Smile Code | O[C@@H]1[C@@H](OCCO)C[C@@H](N2C3=NC(SCCC)=NC(N[C@H]4[C@@H](C5=CC=C(F)C(F)=C5)C4)=C3N=N2)[C@@H]1O |
| Melting Point | NA |
| Boiling Point | NA |
| Production Scale | NULL |
| Production Cycle | NULL |