Parent API
| Product Code | Ax-IMP2704 |
| CAS Number | NA |
| Molecular Formula | C22H21N3O4 |
| Molecular Weight | 391.43 |
| Synonyms | 3-(7-cyano-5-(2-nitropropyl)-1H-indol-1-yl)propyl benzoate |
| Purity | 98.00% |
| MDL No. | NA |
| Smile Code | O=C(OCCCN1C=CC2=C1C(C#N)=CC(CC([N+]([O-])=O)C)=C2)C3=CC=CC=C3 |
| Melting Point | NA |
| Boiling Point | NA |
| Production Scale | NULL |
| Production Cycle | NULL |