Parent API
| Product Code | Ax-IMP398 |
| CAS Number | NA |
| Molecular Formula | C14H24N2O |
| Molecular Weight | 236.35 |
| Synonyms | N-(3-amino-5,7-dimethyl adamantan-1-yl)acetamide |
| Purity | 98.00% |
| MDL No. | NA |
| Smile Code | CC(NC12CC3(N)CC(C2)(C)CC(C3)(C)C1)=O |
| Melting Point | NA |
| Boiling Point | NA |
| Production Scale | NULL |
| Production Cycle | NULL |