Parent API
| Product Code | Ax-IMP151 |
| CAS Number | NA |
| Molecular Formula | C26H29Cl2N5O4 |
| Molecular Weight | 546.45 |
| Synonyms | 4-(3-((3-cyano-4-((2,4-dichloro-5-methoxyphenyl)amino)-6-methoxyquinolin-7-yl)oxy)propyl)-1-methylpiperazine 1-oxide |
| Purity | 92.00% |
| MDL No. | NA |
| Smile Code | COC1=C(C=C(N=CC(C#N)=C2NC3=CC(OC)=C(Cl)C=C3Cl)C2=C1)OCCCN4CC[N+]([O-])(C)CC4 |
| Melting Point | NA |
| Boiling Point | NA |
| Production Scale | NULL |
| Production Cycle | NULL |