Parent API
| Product Code | Ax-IMP153 |
| CAS Number | NA |
| Molecular Formula | C18H13Cl2N3O3 |
| Molecular Weight | 390.22 |
| Synonyms | 4-((2,4-dichloro-5-methoxyphenyl)amino)-7-hydroxy-6-methoxyquinoline-3-carbonitrile |
| Purity | 98.00% |
| MDL No. | NA |
| Smile Code | N#CC1=C(NC2=CC(OC)=C(Cl)C=C2Cl)C3=CC(OC)=C(O)C=C3N=C1 |
| Melting Point | NA |
| Boiling Point | NA |
| Production Scale | NULL |
| Production Cycle | NULL |