Parent API
| Product Code | Ax-11178 |
| CAS Number | 81187-94-2 |
| Molecular Formula | C12H11ClF3NO4 |
| Molecular Weight | 325.67 |
| Synonyms | (Z)-4-amino-3-(4-chlorophenyl)but-2-enoic acid compound with 2,2,2-trifluoroacetic acid (1:1) |
| Purity | >98% |
| Smile Code | O=C(O)/C=C(C1=CC=C(Cl)C=C1)\CN.O=C(O)C(F)(F)F |