Parent API
| Product Code | AX-IMP03 |
| CAS Number | 7640-51-9 |
| Molecular Formula | C17H20N2OS . HCl |
| Molecular Weight | 336.92 |
| Synonyms | N,N,a-Trimethyl-10H-phenothiazine-10-ethanamine 5-Oxide; N-[2-(Dimethylamino)propyl]phenothiazine S-Oxide; Promethazine 5-Oxide |
| Purity | 98.00% |
| MDL No. | NULL |
| Smile Code | Cl[H].CC(CN1C2=C(C=CC=C2)S(=O)C2=C1C=CC=C2)N(C)C |
| Melting Point | 114-117°C |
| Boiling Point | NA |
| Production Scale | NULL |
| Production Cycle | NULL |