Parent API
| Product Code | Ax-IMP2170 |
| CAS Number | 70415-50-8 |
| Molecular Formula | C9H8ClNO5S2 |
| Molecular Weight | 309.75 |
| Synonyms | methyl 6-chloro-4-hydroxy-2-methyl-2H-thieno[2,3-e][1,2]thiazine-3-carboxylate 1,1-dioxide |
| Purity | 96.00% |
| MDL No. | MFCD08063942 |
| Smile Code | O=C(C1=C(O)C2=C(C=C(Cl)S2)S(N1C)(=O)=O)OC |
| Melting Point | 196-206° C |
| Boiling Point | NA |
| Production Scale | NULL |
| Production Cycle | NULL |