Parent API
| Product Code | Ax-IMP134 |
| CAS Number | 356572-08-2 |
| Molecular Formula | C12H22ClNO |
| Molecular Weight | 231.76 |
| Synonyms | 3-Amino-5,7-dimethyltricyclo[3.3.1.13,7]decan-1-ol Hydrochloride |
| Purity | 98.00% |
| MDL No. | NA |
| Smile Code | OC1(C2)CC3(N)CC2(C)CC(C3)(C)C1.[H]Cl |
| Melting Point | 304-306°C |
| Boiling Point | NA |
| Production Scale | NULL |
| Production Cycle | NULL |