Parent API
| Product Code | Ax-IMP2710 |
| CAS Number | 350797-52-3 |
| Molecular Formula | C19H19NO3 |
| Molecular Weight | 309.37 |
| Synonyms | 3-(5-formylindolin-1-yl)propyl benzoate |
| Purity | 98.00% |
| MDL No. | NA |
| Smile Code | O=CC1=CC2=C(N(CCCOC(C3=CC=CC=C3)=O)CC2)C=C1 |
| Melting Point | NA |
| Boiling Point | NA |
| Production Scale | NULL |
| Production Cycle | NULL |