Parent API
| Product Code | Ax-14230 |
| CAS Number | 1643789-81-4 |
| Molecular Formula | C13H15ClO |
| Molecular Weight | 222.71 |
| Synonyms | 4-(2-chloroethyl)-6-methoxy-1,2-dihydronaphthalene |
| Purity | >98% |
| Smile Code | COC1=CC2=C(CCC=C2CCCl)C=C1 |
| Product Code | Ax-14230 |
| CAS Number | 1643789-81-4 |
| Molecular Formula | C13H15ClO |
| Molecular Weight | 222.71 |
| Synonyms | 4-(2-chloroethyl)-6-methoxy-1,2-dihydronaphthalene |
| Purity | >98% |
| Smile Code | COC1=CC2=C(CCC=C2CCCl)C=C1 |