Parent API
| Product Code | Ax-IMP2523 |
| CAS Number | 160969-00-6 |
| Molecular Formula | C10H10BrF3O2 |
| Molecular Weight | 299.08 |
| Synonyms | 1-(2-bromoethoxy)-2-(2,2,2-trifluoroethoxy)benzene |
| Purity | 98.00% |
| MDL No. | MFCD12964172 |
| Smile Code | FC(F)(F)COC1=CC=CC=C1OCCBr |
| Melting Point | NA |
| Boiling Point | NA |
| Production Scale | NULL |
| Production Cycle | NULL |