Parent API
| Product Code | Ax-IMP608 |
| CAS Number | 137862-87-4 |
| Molecular Formula | C24H29N5O3 |
| Molecular Weight | 435.52 |
| Synonyms | N-((2'-(2H-tetrazol-5-yl)-[1,1'-biphenyl]-4-yl)methyl)-N-pentanoyl-D-valine |
| Purity | 90.00% |
| MDL No. | NA |
| Smile Code | CC(C)[C@H](C(O)=O)N(C(CCCC)=O)CC1=CC=C(C2=CC=CC=C2C3=NNN=N3)C=C1 |
| Melting Point | NA |
| Boiling Point | NA |
| Production Scale | NULL |
| Production Cycle | NULL |