Parent API
| Product Code | Ax-IMP2853 |
| CAS Number | 135729-78-1 |
| Molecular Formula | C18H24N2O |
| Molecular Weight | 284.4 |
| Synonyms | (S)-N-(quinuclidin-3-yl)-5,6,7,8-tetrahydronaphthalene-1-carboxamide |
| Purity | >96% |
| MDL No. | NA |
| Smile Code | O=C(C1=C2CCCCC2=CC=C1)N[C@@H]3CN4CCC3CC4 |
| Melting Point | 156 - 160°C |
| Boiling Point | NA |
| Production Scale | NULL |
| Production Cycle | NULL |