Parent API
| Product Code | Ax-IMP2455 |
| CAS Number | 116314-52-4 |
| Molecular Formula | C12H10N2O6 |
| Molecular Weight | 278.22 |
| Synonyms | ethyl (E)-2-cyano-3-(3,4-dihydroxy-5-nitrophenyl)acrylate |
| Purity | 96.00% |
| MDL No. | NA |
| Smile Code | O=C(OCC)/C(C#N)=C/C1=CC([N+]([O-])=O)=C(O)C(O)=C1 |
| Melting Point | NA |
| Boiling Point | NA |
| Production Scale | NULL |
| Production Cycle | NULL |