Parent API
| Product Code | Ax-IMP186 |
| CAS Number | 103733-49-9 |
| Molecular Formula | C25H28N2O4 |
| Molecular Weight | 420.5 |
| Synonyms | ethyl (S)-2-((3S,11aS)-3-methyl-1,4-dioxo-1,3,4,6,11,11a-hexahydro-2H-pyrazino[1,2-b]isoquinolin-2-yl)-4-phenylbutanoate |
| Purity | 98.00% |
| MDL No. | NA |
| Smile Code | O=C(OCC)[C@@H](N([C@@H](C)C1=O)C([C@@]2([H])N1CC3=C(C=CC=C3)C2)=O)CCC4=CC=CC=C4 |
| Melting Point | NA |
| Boiling Point | NA |
| Production Scale | NULL |
| Production Cycle | NULL |