Parent API
| Product Code | Ax-IMP2808 |
| CAS Number | NA |
| Molecular Formula | C12H16N4O2 |
| Molecular Weight | 248.29 |
| Synonyms | tert-butyl ((1H-benzo[d][1,2,3]triazol-1-yl)methyl)carbamate |
| Purity | 98.00% |
| MDL No. | NA |
| Smile Code | O=C(OC(C)(C)C)NCN1N=NC2=CC=CC=C21 |
| Melting Point | NA |
| Boiling Point | NA |
| Production Scale | NULL |
| Production Cycle | NULL |