Parent API
| Product Code | Ax-IMP2807 |
| CAS Number | NA |
| Molecular Formula | C34H38N2O7 |
| Molecular Weight | 586.69 |
| Synonyms | 4-((S)-1-((R)-4-benzyl-2-oxooxazolidin-3-yl)-3-((tert-butoxycarbonyl)amino)-1-oxopropan-2-yl)benzyl 2,4-dimethylbenzoate |
| Purity | >96% |
| MDL No. | NA |
| Smile Code | O=C(OCC1=CC=C([C@@H](CNC(OC(C)(C)C)=O)C(N2C(OC[C@H]2CC3=CC=CC=C3)=O)=O)C=C1)C4=CC=C(C)C=C4C |
| Melting Point | NA |
| Boiling Point | NA |
| Production Scale | NULL |
| Production Cycle | NULL |