Parent API
| Product Code | Ax-IMP1548 |
| CAS Number | NA |
| Molecular Formula | C15H16O3 |
| Molecular Weight | 244.29 |
| Synonyms | 2-(3-((2-oxocyclopentylidene)methyl)phenyl)propanoic acid |
| Purity | 96.00% |
| MDL No. | NA |
| Smile Code | O=C1C(CCC1)=CC2=CC(C(C)C(O)=O)=CC=C2 |
| Melting Point | NA |
| Boiling Point | NA |
| Production Scale | NULL |
| Production Cycle | NULL |