Parent API
| Product Code | Ax-IMP2287 |
| CAS Number | Ax-IMP2287 |
| Molecular Formula | C35H43N7O5 |
| Molecular Weight | 641.77 |
| Synonyms | propyl (Z)-3-(2-(((4-(N'-((hexyloxy)carbonyl)carbamimidoyl)phenyl)amino)methyl)-1-methyl-N-(pyridin-2-yl)-1H-benzo[d]imidazole-5-carboxamido)propanoate |
| Purity | 94.00% |
| MDL No. | NA |
| Smile Code | O=C(OCCC)CCN(C1=NC=CC=C1)C(C2=CC=C3N(C)C(CNC4=CC=C(/C(N)=N/C(OCCCCCC)=O)C=C4)=NC3=C2)=O |
| Melting Point | NA |
| Boiling Point | NA |
| Production Scale | NULL |
| Production Cycle | NULL |