Parent API
| Product Code | Ax-IMP2614 |
| CAS Number | 943986-67-2 |
| Molecular Formula | C11H19NO3 |
| Molecular Weight | 213.28 |
| Synonyms | (S)-2-((R)-2-oxo-4-propylpyrrolidin-1-yl)butanoic acid |
| Purity | 96.00% |
| MDL No. | NA |
| Smile Code | CC[C@H](N1C(C[C@@H](CCC)C1)=O)C(O)=O |
| Melting Point | NA |
| Boiling Point | NA |
| Production Scale | NULL |
| Production Cycle | NULL |