Parent API
| Product Code | Ax-IMP933 |
| CAS Number | 877265-30-0 ; 187540-01-8 |
| Molecular Formula | C21H26ClN |
| Molecular Weight | 327.9 |
| Synonyms | (E)-N,6,6-trimethyl-N-(naphthalen-2-ylmethyl)hept-2-en-4-yn-1-amine hydrochloride |
| Purity | 98.00% |
| MDL No. | NA |
| Smile Code | CC(C)(C)C#C/C=C/CN(C)CC1=CC=C2C=CC=CC2=C1.[H]Cl |
| Melting Point | NA |
| Boiling Point | NA |
| Production Scale | NULL |
| Production Cycle | NULL |