Parent API
| Product Code | Ax-IMP1987 |
| CAS Number | 328055-92-1 |
| Molecular Formula | C14H15N3 |
| Molecular Weight | 225.3 |
| Synonyms | 8-methyl-7,8,9,10-tetrahydro-6H-6,10-methanoazepino[4,5-g]quinoxaline |
| Purity | 92.00% |
| MDL No. | NA |
| Smile Code | CN1CC(C2)C3=CC4=NC=CN=C4C=C3C2C1 |
| Melting Point | NA |
| Boiling Point | NA |
| Production Scale | NULL |
| Production Cycle | NULL |