Parent API
| Product Code | Ax-IMP751 |
| CAS Number | 295357-66-3 |
| Molecular Formula | C13H14N2O5 |
| Molecular Weight | 278.26 |
| Synonyms | 2-(4-amino-1-oxoisoindolin-2-yl)pentanedioic acid |
| Purity | 92.00% |
| MDL No. | NA |
| Smile Code | O=C(O)C(N(CC1=C2C=CC=C1N)C2=O)CCC(O)=O |
| Melting Point | NA |
| Boiling Point | NA |
| Production Scale | NULL |
| Production Cycle | NULL |