Parent API
| Product Code | Ax-IMP2451 |
| CAS Number | 26405-77-6 |
| Molecular Formula | C9H13NO5S |
| Molecular Weight | 247.26 |
| Synonyms | 1-(3,4-dihydroxyphenyl)-2-(methylamino)ethane-1-sulfonic acid |
| Purity | 98.00% |
| MDL No. | NA |
| Smile Code | O=S(C(CNC)C1=CC=C(O)C(O)=C1)(O)=O |
| Melting Point | >232° C |
| Boiling Point | NA |
| Production Scale | NULL |
| Production Cycle | NULL |