Parent API
| Product Code | Ax-IMP2286 |
| CAS Number | 211915-00-3 |
| Molecular Formula | C33H39N7O5 |
| Molecular Weight | 613.72 |
| Synonyms | methyl (Z)-3-(2-(((4-(N'-((hexyloxy)carbonyl)carbamimidoyl)phenyl)amino)methyl)-1-methyl-N-(pyridin-2-yl)-1H-benzo[d]imidazole-5-carboxamido)propanoate |
| Purity | 94.00% |
| MDL No. | NA |
| Smile Code | O=C(OC)CCN(C1=NC=CC=C1)C(C2=CC=C3N(C)C(CNC4=CC=C(/C(N)=N/C(OCCCCCC)=O)C=C4)=NC3=C2)=O |
| Melting Point | NA |
| Boiling Point | NA |
| Production Scale | NULL |
| Production Cycle | NULL |