Parent API
| Product Code | Ax-IMP2767 |
| CAS Number | 182627-95-8 |
| Molecular Formula | C11H10BrN5O2 |
| Molecular Weight | 324.14 |
| Synonyms | 5-bromo-6-((4,5-dihydro-1H-imidazol-2-yl)amino)-1,4-dihydroquinoxaline-2,3-dione |
| Purity | 98.00% |
| MDL No. | NA |
| Smile Code | O=C1NC2=C(C(Br)=C(NC3=NCCN3)C=C2)NC1=O |
| Melting Point | >243°C |
| Boiling Point | NA |
| Production Scale | NULL |
| Production Cycle | NULL |