Parent API
| Product Code | Ax-IMP1416 |
| CAS Number | 180468-38-6 |
| Molecular Formula | C23H26N2O2 |
| Molecular Weight | 362.47 |
| Synonyms | (S)-quinuclidin-3-yl (S)-1-phenyl-3,4-dihydroisoquinoline-2(1H)-carboxylate |
| Purity | 94.00% |
| MDL No. | NA |
| Smile Code | O=C(N1[C@@H](C2=CC=CC=C2)C3=C(C=CC=C3)CC1)O[C@@H]4CN5CCC4CC5 |
| Melting Point | NA |
| Boiling Point | NA |
| Production Scale | NULL |
| Production Cycle | NULL |