Parent API
| Product Code | Ax-IMP1148 |
| CAS Number | 180272-45-1 |
| Molecular Formula | C15H15N |
| Molecular Weight | 209.29 |
| Synonyms | (R)-1-phenyl-1,2,3,4-tetrahydroisoquinoline |
| Purity | 98.00% |
| MDL No. | NA |
| Smile Code | [C@H]1(C2=CC=CC=C2)NCCC3=C1C=CC=C3 |
| Melting Point | 78-79? |
| Boiling Point | NA |
| Production Scale | NULL |
| Production Cycle | NULL |