Parent API
| Product Code | Ax-IMP2498 |
| CAS Number | 1408238-40-3 |
| Molecular Formula | C34H40N6O6 |
| Molecular Weight | 628.72 |
| Synonyms | ethyl 3-(2-(((4-(((hexyloxy)carbonyl)carbamoyl)phenyl)amino)methyl)-1-methyl-N-(pyridin-2-yl)-1H-benzo[d]imidazole-5-carboxamido)propanoate |
| Purity | 92.00% |
| MDL No. | NA |
| Smile Code | O=C(OCC)CCN(C1=NC=CC=C1)C(C2=CC=C3N(C)C(CNC4=CC=C(C(NC(OCCCCCC)=O)=O)C=C4)=NC3=C2)=O |
| Melting Point | NA |
| Boiling Point | NA |
| Production Scale | NULL |
| Production Cycle | NULL |