Parent API
| Product Code | Ax-IMP1154 |
| CAS Number | 139122-19-3 |
| Molecular Formula | C10H11NO2 |
| Molecular Weight | 177.2 |
| Synonyms | 4-(2-hydroxyethyl)indolin-2-one |
| Purity | 98.00% |
| MDL No. | MFCD07782133 |
| Smile Code | O=C1NC2=C(C(CCO)=CC=C2)C1 |
| Melting Point | 151 - 155°C |
| Boiling Point | NA |
| Production Scale | NULL |
| Production Cycle | NULL |