Parent API
| Product Code | Ax-IMP1614 |
| CAS Number | 135308-74-6 |
| Molecular Formula | C15H23NO2 |
| Molecular Weight | 249.35 |
| Synonyms | 4-(1-(1-hydroxycyclohexyl)-2-(methylamino)ethyl)phenol |
| Purity | 96.00% |
| MDL No. | NA |
| Smile Code | OC1=CC=C(C(C2(O)CCCCC2)CNC)C=C1 |
| Melting Point | 164-166°C |
| Boiling Point | NA |
| Production Scale | NULL |
| Production Cycle | NULL |