Parent API
| Product Code | Ax-IMP2789 |
| CAS Number | 1181267-33-3 |
| Molecular Formula | C13H17ClO2 |
| Molecular Weight | 240.73 |
| Synonyms | methyl 2-(4-(2-chloroethyl)phenyl)-2-methylpropanoate |
| Purity | >96 |
| MDL No. | NA |
| Smile Code | CC(C)(C1=CC=C(CCCl)C=C1)C(OC)=O |
| Melting Point | NA |
| Boiling Point | NA |
| Production Scale | NULL |
| Production Cycle | NULL |