Parent API
| Product Code | Ax-IMP977 |
| CAS Number | 1076199-41-1 |
| Molecular Formula | C16H24N2O2 |
| Molecular Weight | 276.38 |
| Synonyms | N-(2-(2-oxoindolin-4-yl)ethyl)-N-propylpropan-1-amine oxide |
| Purity | 94.00% |
| MDL No. | NA |
| Smile Code | O=C1NC2=C(C(CC[N+](CCC)([O-])CCC)=CC=C2)C1 |
| Melting Point | 38-40°C |
| Boiling Point | NA |
| Production Scale | NULL |
| Production Cycle | NULL |