Entacapone Impurity B

Parent API
Product CodeAx-IMP2455
CAS Number116314-52-4
Synonymsethyl (E)-2-cyano-3-(3,4-dihydroxy-5-nitrophenyl)acrylate
Molecular FormulaC12H10N2O6
Molecular Weight278.22
Purity 96.00%
MDL No. NA
Smile Code O=C(OCC)/C(C#N)=C/C1=CC([N+]([O-])=O)=C(O)C(O)=C1
Melting Point NA
Boiling Point NA
Production Scale NULL
Production Cycle NULL